EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | [H][C@@]12C[C@@H](CC[C@H](O)/C(C)=C/C[C@@H]1C(=C)C)C(=O)O2 |
| InChI | InChI=1S/C15H22O3/c1-9(2)12-6-4-10(3)13(16)7-5-11-8-14(12)18-15(11)17/h4,11-14,16H,1,5-8H2,2-3H3/b10-4+/t11-,12-,13+,14-/m1/s1 |
| InChIKey | COEDSYSRVAUHQU-GEHWQCAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Viola yedoensis (ncbitaxon:316493) | leaf (BTO:0000713) | PubMed (25562805) | |
| Aristolochia versicolar (ncbitaxon:1523942) | root (BTO:0001188) | PubMed (3788595) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| versicolactone B (CHEBI:132826) has role plant metabolite (CHEBI:76924) |
| versicolactone B (CHEBI:132826) is a germacrane sesquiterpenoid (CHEBI:68588) |
| versicolactone B (CHEBI:132826) is a olefinic compound (CHEBI:78840) |
| versicolactone B (CHEBI:132826) is a oxabicycloalkane (CHEBI:46733) |
| versicolactone B (CHEBI:132826) is a secondary alcohol (CHEBI:35681) |
| versicolactone B (CHEBI:132826) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (1R,4S,5E,8R,9R)-4-hydroxy-5-methyl-8-(prop-1-en-2-yl)-10-oxabicyclo[7.2.1]dodec-5-en-11-one |
| Manual Xrefs | Databases |
|---|---|
| C00033470 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27710224 | Reaxys |
| CAS:104613-44-7 | ChemIDplus |
| Citations |
|---|