EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31NO8 |
| Net Charge | 0 |
| Average Mass | 557.599 |
| Monoisotopic Mass | 557.20497 |
| SMILES | [H]C(=O)/C1=C\[C@H](OC(=O)c2cc3c(c4c2c([N+](=O)[O-])cc2c(OC)cccc24)OCO3)C/C(C)=C/CC/C(C)=C/CC1 |
| InChI | InChI=1S/C32H31NO8/c1-19-7-4-9-20(2)13-22(14-21(17-34)10-5-8-19)41-32(35)25-16-28-31(40-18-39-28)30-23-11-6-12-27(38-3)24(23)15-26(29(25)30)33(36)37/h6,8-9,11-12,14-17,22H,4-5,7,10,13,18H2,1-3H3/b19-8+,20-9+,21-14-/t22-/m1/s1 |
| InChIKey | CNCKKGCRDGSHDH-PTDIUHGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aristolochia heterophylla (ncbitaxon:431268) | |||
| root (BTO:0001188) | PubMed (10096848) | ||
| stem (BTO:0001300) | PubMed (10096848) | ||
| Aristolochia mollissima (ncbitaxon:158558) | amniotic fluid (BTO:0000068) | Article (Acta pharmaceutica Sinica (1996), 31, 446-450) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aristoloterpenate-I (CHEBI:132825) has functional parent aristolochic acid A (CHEBI:2825) |
| aristoloterpenate-I (CHEBI:132825) has role plant metabolite (CHEBI:76924) |
| aristoloterpenate-I (CHEBI:132825) is a C-nitro compound (CHEBI:35716) |
| aristoloterpenate-I (CHEBI:132825) is a aromatic ester (CHEBI:62732) |
| aristoloterpenate-I (CHEBI:132825) is a aromatic ether (CHEBI:35618) |
| aristoloterpenate-I (CHEBI:132825) is a cyclic acetal (CHEBI:59770) |
| aristoloterpenate-I (CHEBI:132825) is a enal (CHEBI:51688) |
| aristoloterpenate-I (CHEBI:132825) is a macrocycle (CHEBI:51026) |
| aristoloterpenate-I (CHEBI:132825) is a organic heterotetracyclic compound (CHEBI:38163) |
| aristoloterpenate-I (CHEBI:132825) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1R,2Z,6E,10E)-3-formyl-7,11-dimethylcyclododeca-2,6,10-trien-1-yl 8-methoxy-6-nitro-2H-phenanthro[3,4-d][1,3]dioxole-5-carboxylate |
| Synonyms | Source |
|---|---|
| (-)-Aristoloterpenate I | KNApSAcK |
| Aristoloterpenate I | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00027291 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8744291 | Reaxys |
| CAS:184955-22-4 | KNApSAcK |
| Citations |
|---|