EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132824 - spathulenol
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | [H][C@]12[C@H]3[C@@H](CCC(=C)[C@]1([H])CC[C@]2(C)O)C3(C)C |
| InChI | InChI=1S/C15H24O/c1-9-5-6-11-13(14(11,2)3)12-10(9)7-8-15(12,4)16/h10-13,16H,1,5-8H2,2-4H3/t10-,11+,12+,13+,15-/m0/s1 |
| InChIKey | FRMCCTDTYSRUBE-BGPZULBFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xanthium strumarium (ncbitaxon:318068) | aerial part (BTO:0001658) | PubMed (27169184) | |
| Alisma orientale (ncbitaxon:262913) | tuber (BTO:0001400) | PubMed (26666273) | |
| Eugenia uniflora (ncbitaxon:119951) | leaf (BTO:0000713) | PubMed (27447784) | |
| Stachys annua (ncbitaxon:1391948) | aerial part (BTO:0001658) | PubMed (26265569) | |
| Annonaceae (ncbitaxon:22140) | fruit (BTO:0000486) | PubMed (26920282) | |
| Lophostemon suaveolens (ncbitaxon:271919) | leaf (BTO:0000713) | PubMed (25942679) | |
| Bupleurum (ncbitaxon:46366) | |||
| flower (BTO:0000469) | PubMed (26996033) | ||
| fruit (BTO:0000486) | PubMed (26996033) | ||
| Salvia mirzayanii (ncbitaxon:1571167) | - | PubMed (20857430) | Isolated from methanol extract |
| Clinopodium chinense (ncbitaxon:516070) | - | PubMed (26408136) | Obtained from the essential oil |
| Murraya microphylla (ncbitaxon:1224774) | - | PubMed (26594776) | Obtained from the essential oil |
| Aloysia gratissima (ncbitaxon:105888) | - | PubMed (26221984) | Obtained from the essential oil |
| Cryptocarya lividula (ncbitaxon:1118764) | leaf (BTO:0000713) | PubMed (27032214) | |
| Actinodaphne pruinosa (ncbitaxon:489012) | leaf (BTO:0000713) | PubMed (27534134) | |
| Ocotea pulchella (ncbitaxon:128671) | |||
| leaf (BTO:0000713) | PubMed (27482860) | ||
| root (BTO:0001188) | PubMed (27482860) | ||
| stem (BTO:0001300) | PubMed (27482860) | ||
| Glycosmis lucida (ncbitaxon:1224769) | leaf (BTO:0000713) | PubMed (27563800) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. anaesthetic Substance which produces loss of feeling or sensation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spathulenol (CHEBI:132824) has role anaesthetic (CHEBI:38867) |
| spathulenol (CHEBI:132824) has role plant metabolite (CHEBI:76924) |
| spathulenol (CHEBI:132824) has role vasodilator agent (CHEBI:35620) |
| spathulenol (CHEBI:132824) has role volatile oil component (CHEBI:27311) |
| spathulenol (CHEBI:132824) is a carbotricyclic compound (CHEBI:38032) |
| spathulenol (CHEBI:132824) is a olefinic compound (CHEBI:78840) |
| spathulenol (CHEBI:132824) is a sesquiterpenoid (CHEBI:26658) |
| spathulenol (CHEBI:132824) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidenedecahydro-1H-cyclopropa[e]azulen-7-ol |
| Manual Xrefs | Databases |
|---|---|
| C00000149 | KNApSAcK |
| HMDB0036420 | HMDB |
| Spathulenol | Wikipedia |
| EP0150525 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4671447 | Reaxys |
| CAS:6750-60-3 | ChemIDplus |
| Citations |
|---|