EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H50O |
| Net Charge | 0 |
| Average Mass | 414.718 |
| Monoisotopic Mass | 414.38617 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](CC)C(C)C |
| InChI | InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21+,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | KZJWDPNRJALLNS-FBZNIEFRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dragmacidon coccineum (ncbitaxon:1807045) | - | PubMed (24831420) | |
| Elaeis guineensis (ncbitaxon:51953) | - | PubMed (27694009) | |
| Polygala tenuifolia (ncbitaxon:355332) | rhizome (BTO:0001181) | PubMed (22863942) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clionasterol (CHEBI:132823) has parent hydride poriferastane (CHEBI:26211) |
| clionasterol (CHEBI:132823) has role marine metabolite (CHEBI:76507) |
| clionasterol (CHEBI:132823) has role plant metabolite (CHEBI:76924) |
| clionasterol (CHEBI:132823) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| clionasterol (CHEBI:132823) is a 3β-sterol (CHEBI:35348) |
| clionasterol (CHEBI:132823) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (24S)-stigmast-5-en-3β-ol |
| Synonyms | Source |
|---|---|
| 22,23-Dihydroporiferasterol | NIST Chemistry WebBook |
| 24-Ethylcholest-5-en-3 beta-ol | HMDB |
| 24S-ethylcholest-5-en-3β-ol | HMDB |
| 24β-ethyl-5-cholesten-3β-ol | NIST Chemistry WebBook |
| 24β-ethylcholesterol | HMDB |
| (3β,24S)-stigmast-5-en-3-ol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C00023769 | KNApSAcK |
| HMDB0000649 | HMDB |
| LMST01040122 | LIPID MAPS |
| Citations |
|---|