EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O5 |
| Net Charge | 0 |
| Average Mass | 250.250 |
| Monoisotopic Mass | 250.08412 |
| SMILES | [H][C@]12CO[C@H](c3ccc(O)c(OC)c3)[C@@]1([H])COC2=O |
| InChI | InChI=1S/C13H14O5/c1-16-11-4-7(2-3-10(11)14)12-8-5-18-13(15)9(8)6-17-12/h2-4,8-9,12,14H,5-6H2,1H3/t8-,9-,12+/m0/s1 |
| InChIKey | HYZRWYQBGNTGTK-HOTUBEGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eucommia ulmoides (ncbitaxon:4392) | - | PubMed (26767291) | |
| Sesamum indicum (ncbitaxon:4182) | seed (BTO:0001226) | PubMed (11540412) | |
| Wikstroemia indica (ncbitaxon:714517) | root (BTO:0001188) | PubMed (24660446) | Obtained from the powdered roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salicifoliol (CHEBI:132822) has role plant metabolite (CHEBI:76924) |
| salicifoliol (CHEBI:132822) is a furofuran (CHEBI:47790) |
| salicifoliol (CHEBI:132822) is a guaiacols (CHEBI:134251) |
| salicifoliol (CHEBI:132822) is a lignan (CHEBI:25036) |
| salicifoliol (CHEBI:132822) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,6aR)-4-(4-hydroxy-3-methoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21633389 | Reaxys |
| Citations |
|---|