EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O7 |
| Net Charge | 0 |
| Average Mass | 520.707 |
| Monoisotopic Mass | 520.34000 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@](C(=O)O)(CC[C@@H](C)[C@@]4(C)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(CO)(CO)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O7/c1-17-8-11-29(24(35)36)13-12-26(3)18(22(29)28(17,5)37)6-7-20-25(2)14-19(33)23(34)30(15-31,16-32)21(25)9-10-27(20,26)4/h6,17,19-23,31-34,37H,7-16H2,1-5H3,(H,35,36)/t17-,19-,20-,21-,22-,23+,25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | RIFJXBJHRYLRKR-YTOUHQNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rudgea viburnioides (ncbitaxon:1525326) | ripe fruit (PO:0007038) | PubMed (9677278) | |
| Vochysia (ncbitaxon:39994) | - | PubMed (15798995) | |
| Poraqueiba (ncbitaxon:597259) | stem (BTO:0001300) | PubMed (27736194) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trachelosperogenin B (CHEBI:132819) has parent hydride ursane (CHEBI:35711) |
| trachelosperogenin B (CHEBI:132819) has role plant metabolite (CHEBI:76924) |
| trachelosperogenin B (CHEBI:132819) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| trachelosperogenin B (CHEBI:132819) is a pentacyclic triterpenoid (CHEBI:25872) |
| trachelosperogenin B (CHEBI:132819) is a pentol (CHEBI:37205) |
| IUPAC Name |
|---|
| 2α,3β,19,23,24-pentahydroxyurs-12-en-28-oic acid |
| Synonym | Source |
|---|---|
| (2α,3β)-2,3,19,23,24-pentahydroxyurs-12-en-28-oic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 23259303 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6019862 | Reaxys |
| Citations |
|---|