EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O12 |
| Net Charge | 0 |
| Average Mass | 522.503 |
| Monoisotopic Mass | 522.17373 |
| SMILES | [H][C@]12O[C@]3(O)C[C@](C)(O1)[C@@]1(O[C@@H]4O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]4O)C[C@]3([H])[C@@]21COC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30O12/c1-12(26)32-9-14-16(27)17(28)18(29)20(34-14)35-25-8-15-23(25,11-33-19(30)13-6-4-3-5-7-13)21-36-22(25,2)10-24(15,31)37-21/h3-7,14-18,20-21,27-29,31H,8-11H2,1-2H3/t14-,15-,16-,17+,18-,20+,21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | RKEWKGLURKYHJJ-YBBFZNMFSA-N |
| Roles Classification |
|---|
| Applications: | anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) has functional parent paeoniflorin (CHEBI:7889) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) has role anti-allergic agent (CHEBI:50857) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) has role anti-inflammatory agent (CHEBI:67079) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a O-acyl carbohydrate (CHEBI:52782) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a acetate ester (CHEBI:47622) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a benzoate ester (CHEBI:36054) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a bridged compound (CHEBI:35990) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a cyclic acetal (CHEBI:59770) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a lactol (CHEBI:38131) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a monoterpene glycoside (CHEBI:72293) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a semisynthetic derivative (CHEBI:72588) |
| 6'-O-acetylpaeoniflorin (CHEBI:132815) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| [(1aR,2S,3aR,5R,5aR,5bS)-1a-[(6-O-acetyl-β-D-glucopyranosyl)oxy]-5-hydroxy-2-methyltetrahydro-1H-2,5-methano-3,4-dioxacyclobuta[cd]pentalen-5b(3aH)-yl]methyl benzoate |
| Synonym | Source |
|---|---|
| 6'-acetylpaeoniflorin | ChEBI |
| Citations |
|---|