EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H17ClN4O3 |
| Net Charge | 0 |
| Average Mass | 456.889 |
| Monoisotopic Mass | 456.09892 |
| SMILES | O=c1cc(-c2ccc([N+](=O)[O-])cc2)nc2c(-c3ccc(Cl)cc3)c(Cc3ccccc3)nn12 |
| InChI | InChI=1S/C25H17ClN4O3/c26-19-10-6-18(7-11-19)24-22(14-16-4-2-1-3-5-16)28-29-23(31)15-21(27-25(24)29)17-8-12-20(13-9-17)30(32)33/h1-13,15,27H,14H2 |
| InChIKey | GUUWHOSUKOCRHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NAV2729 (CHEBI:132811) has role inhibitor (CHEBI:35222) |
| NAV2729 (CHEBI:132811) is a C-nitro compound (CHEBI:35716) |
| NAV2729 (CHEBI:132811) is a monochlorobenzenes (CHEBI:83403) |
| NAV2729 (CHEBI:132811) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 2-benzyl-3-(4-chlorophenyl)-5-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidin-7(4H)-one |
| Synonyms | Source |
|---|---|
| 2-benzyl-3-(4-chlorophenyl)-5-(4-nitrophenyl)-4H-pyrazolo[1,5-a]pyrimidin-7-one | ChEBI |
| NAV-2729 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2015183989 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24485055 | Reaxys |
| Citations |
|---|