EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O5 |
| Net Charge | 0 |
| Average Mass | 374.477 |
| Monoisotopic Mass | 374.20932 |
| SMILES | CC/C=C\CC(=O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H30O5/c1-2-3-9-14-19(23)15-10-6-4-5-7-11-16-20(24)21(25)17-12-8-13-18-22(26)27/h3-12,15-16,20-21,24-25H,2,13-14,17-18H2,1H3,(H,26,27)/b6-4-,7-5+,9-3-,12-8-,15-10+,16-11+/t20-,21+/m1/s1 |
| InChIKey | UKRCOMRGFCFHQM-VPHBCXEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (17244615) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-oxoresolvin D1 (CHEBI:132800) has role human xenobiotic metabolite (CHEBI:76967) |
| 17-oxoresolvin D1 (CHEBI:132800) is a diol (CHEBI:23824) |
| 17-oxoresolvin D1 (CHEBI:132800) is a enone (CHEBI:51689) |
| 17-oxoresolvin D1 (CHEBI:132800) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 17-oxoresolvin D1 (CHEBI:132800) is a oxo fatty acid (CHEBI:59644) |
| 17-oxoresolvin D1 (CHEBI:132800) is a resolvin (CHEBI:132120) |
| 17-oxoresolvin D1 (CHEBI:132800) is a secondary allylic alcohol (CHEBI:134396) |
| 17-oxoresolvin D1 (CHEBI:132800) is conjugate acid of 17-oxoresolvin D1(1−) (CHEBI:132081) |
| Incoming Relation(s) |
| 17-oxoresolvin D1(1−) (CHEBI:132081) is conjugate base of 17-oxoresolvin D1 (CHEBI:132800) |
| IUPAC Name |
|---|
| (4Z,7S,8R,9E,11E,13Z,15E,19Z)-7,8-dihydroxy-17-oxodocosa-4,9,11,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 17-oxo-(7S,8R)-dihydroxy-(4Z,9E,11E,13Z,15E,19Z)-docosahexaenoic acid | ChEBI |
| 17-oxo-RvD1 | LIPID MAPS |
| 17-oxo-7S,8R-dihydroxy-4Z,9E,11E,13Z,15E,19Z-docosahexaenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA04000080 | LIPID MAPS |
| Citations |
|---|