EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O10 |
| Net Charge | 0 |
| Average Mass | 446.493 |
| Monoisotopic Mass | 446.21520 |
| SMILES | CO[C@H]1O[C@@H](/C(O[C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)=C2\CC[C@@H]3C[C@H]2C3(C)C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H34O10/c1-21(2)8-4-5-9(10(21)6-8)17(30-20-15(26)12(23)11(22)7-29-20)18-14(25)13(24)16(27)19(28-3)31-18/h8,10-16,18-20,22-27H,4-7H2,1-3H3/b17-9-/t8-,10-,11+,12+,13+,14+,15-,16-,18-,19+,20+/m1/s1 |
| InChIKey | QIJSFUZTJUWHOM-SILVWKIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia lactiflora (ncbitaxon:35924) | root (BTO:0001188) | DOI (10.2174/092986712800229032) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinen-10-yl vicianoside (CHEBI:132794) has functional parent β-pinene (CHEBI:50025) |
| pinen-10-yl vicianoside (CHEBI:132794) has role plant metabolite (CHEBI:76924) |
| pinen-10-yl vicianoside (CHEBI:132794) is a disaccharide derivative (CHEBI:63353) |
| pinen-10-yl vicianoside (CHEBI:132794) is a monoterpene glycoside (CHEBI:72293) |
| IUPAC Name |
|---|
| methyl 6-O-α-L-arabinopyranosyl-6-C-[(1S,5R)-6,6-dimethylbicyclo[3.1.1]heptan-2-ylidene]-β-L-idopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26177965 | Reaxys |
| CAS:88623-94-3 | ChemIDplus |