EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22N4O3S2 |
| Net Charge | 0 |
| Average Mass | 466.588 |
| Monoisotopic Mass | 466.11333 |
| SMILES | CC(=O)Nc1nc(-c2cccc(NS(=O)(=O)c3cccc4c(N(C)C)cccc34)c2)cs1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-15(28)24-23-25-20(14-31-23)16-7-4-8-17(13-16)26-32(29,30)22-12-6-9-18-19(22)10-5-11-21(18)27(2)3/h4-14,26H,1-3H3,(H,24,25,28) |
| InChIKey | LBSMEKVVMYSTIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HA15 (CHEBI:132781) has role antineoplastic agent (CHEBI:35610) |
| HA15 (CHEBI:132781) is a 1,3-thiazoles (CHEBI:38418) |
| HA15 (CHEBI:132781) is a acetamides (CHEBI:22160) |
| HA15 (CHEBI:132781) is a aminonaphthalene (CHEBI:38034) |
| HA15 (CHEBI:132781) is a biaryl (CHEBI:64459) |
| HA15 (CHEBI:132781) is a sulfonamide (CHEBI:35358) |
| HA15 (CHEBI:132781) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-{4-[3-({[5-(dimethylamino)-1-naphthyl]sulfonyl}amino)phenyl]-1,3-thiazol-2-yl}acetamide |
| Synonyms | Source |
|---|---|
| N-(4-{3-[5-(dimethylamino)naphthalene-1-sulfonamido]phenyl}thiazol-2-yl)acetamide | ChEBI |
| HA-15 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26947881 | Reaxys |
| Citations |
|---|