EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O6 |
| Net Charge | 0 |
| Average Mass | 322.357 |
| Monoisotopic Mass | 322.14164 |
| SMILES | CCO[C@H](c1cc2ccc(=O)oc2cc1OC)[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C17H22O6/c1-5-22-15(16(19)17(2,3)20)11-8-10-6-7-14(18)23-12(10)9-13(11)21-4/h6-9,15-16,19-20H,5H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | SPEUNNBYNAGBGC-HZPDHXFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica pubescens (ncbitaxon:312530) | root (BTO:0001188) | PubMed (17238120) | EtOAc-soluble fraction |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| angelol-J (CHEBI:132768) has role plant metabolite (CHEBI:76924) |
| angelol-J (CHEBI:132768) has role platelet aggregation inhibitor (CHEBI:50427) |
| angelol-J (CHEBI:132768) is a aromatic ether (CHEBI:35618) |
| angelol-J (CHEBI:132768) is a coumarins (CHEBI:23403) |
| angelol-J (CHEBI:132768) is a diol (CHEBI:23824) |
| IUPAC Name |
|---|
| 6-[(1R,2R)-1-ethoxy-2,3-dihydroxy-3-methylbutyl]-7-methoxy-2H-chromen-2-one |
| Synonym | Source |
|---|---|
| angelol J | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7387555 | Reaxys |
| Citations |
|---|