EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132764 - sodium oxalate
| Formula | C2O4.2Na |
| Net Charge | 0 |
| Average Mass | 133.998 |
| Monoisotopic Mass | 133.95920 |
| SMILES | O=C([O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C2H2O4.2Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| InChIKey | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Biological Role: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium oxalate (CHEBI:132764) has part oxalate(2−) (CHEBI:30623) |
| sodium oxalate (CHEBI:132764) has role poison (CHEBI:64909) |
| sodium oxalate (CHEBI:132764) has role reducing agent (CHEBI:63247) |
| sodium oxalate (CHEBI:132764) is a organic sodium salt (CHEBI:38700) |
| sodium oxalate (CHEBI:132764) is a oxalate salt (CHEBI:64148) |
| IUPAC Name |
|---|
| disodium ethanedioate |
| Synonyms | Source |
|---|---|
| Disodium oxalate | ChemIDplus |
| Ethanedioic acid, disodium salt | ChemIDplus |
| Natriumoxalat | ChemIDplus |
| Oxalic acid, disodium salt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Sodium_oxalate | Wikipedia |
| Citations |
|---|