EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO4 |
| Net Charge | 0 |
| Average Mass | 325.364 |
| Monoisotopic Mass | 325.13141 |
| SMILES | [H][C@@]12Cc3ccc(OC)c(O)c3CN1CCc1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C19H19NO4/c1-22-16-3-2-11-6-15-13-8-18-17(23-10-24-18)7-12(13)4-5-20(15)9-14(11)19(16)21/h2-3,7-8,15,21H,4-6,9-10H2,1H3/t15-/m0/s1 |
| InChIKey | PQECCKIOFCWGRJ-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eschscholzia californica (ncbitaxon:3467) | - | PubMed (17250743) | |
| Argemone mexicana (ncbitaxon:54796) | - | PubMed (21094631) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-nandinine (CHEBI:132749) has role anti-obesity agent (CHEBI:74518) |
| (S)-nandinine (CHEBI:132749) has role plant metabolite (CHEBI:76924) |
| (S)-nandinine (CHEBI:132749) is a aromatic ether (CHEBI:35618) |
| (S)-nandinine (CHEBI:132749) is a berberine alkaloid (CHEBI:22754) |
| (S)-nandinine (CHEBI:132749) is a organic heteropentacyclic compound (CHEBI:38164) |
| (S)-nandinine (CHEBI:132749) is a phenols (CHEBI:33853) |
| (S)-nandinine (CHEBI:132749) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| (S)-canadine (CHEBI:16592) has functional parent (S)-nandinine (CHEBI:132749) |
| IUPAC Name |
|---|
| (13aS)-10-methoxy-5,8,13,13a-tetrahydro-2H,6H-[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinolin-9-ol |
| Synonyms | Source |
|---|---|
| (+)-Nandinin | ChemIDplus |
| (+)-nandinine | ChEBI |
| S-Tetrahydroberberrubine | ChemIDplus |
| 10-Methoxy-2,3-(methylenedioxy)berbin-9-ol | ChemIDplus |
| Nandinine | ChemIDplus |
| (+)-Tetrahydroberberrubine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (S)-nandinine | UniProt |
| Citations |
|---|