EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132719 - bianfugenine
| Formula | C20H17NO5 |
| Net Charge | 0 |
| Average Mass | 351.358 |
| Monoisotopic Mass | 351.11067 |
| SMILES | COc1ccc2c(c1)C(=O)c1c(OC)c(OC)c(OC)c3ccnc-2c13 |
| InChI | InChI=1S/C20H17NO5/c1-23-10-5-6-11-13(9-10)17(22)15-14-12(7-8-21-16(11)14)18(24-2)20(26-4)19(15)25-3/h5-9H,1-4H3 |
| InChIKey | OOWSNEKQIRVGCG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinomenium acutum (ncbitaxon:152363) | |||
| stem (BTO:0001300) | PubMed (16964757) | ||
| rhizome (BTO:0001181) | PubMed (23059629) | ||
| Menispermum dauricum (ncbitaxon:49683) | rhizome (BTO:0001181) | PubMed (8281582) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bianfugenine (CHEBI:132719) has role antineoplastic agent (CHEBI:35610) |
| bianfugenine (CHEBI:132719) has role plant metabolite (CHEBI:76924) |
| bianfugenine (CHEBI:132719) has role platelet aggregation inhibitor (CHEBI:50427) |
| bianfugenine (CHEBI:132719) is a aromatic ether (CHEBI:35618) |
| bianfugenine (CHEBI:132719) is a aromatic ketone (CHEBI:76224) |
| bianfugenine (CHEBI:132719) is a cyclic ketone (CHEBI:3992) |
| bianfugenine (CHEBI:132719) is a isoquinoline alkaloid (CHEBI:24921) |
| bianfugenine (CHEBI:132719) is a organic heterotetracyclic compound (CHEBI:38163) |
| bianfugenine (CHEBI:132719) is a polyether (CHEBI:46774) |
| IUPAC Name |
|---|
| 4,5,6,9-tetramethoxy-7H-dibenzo[de,h]quinolin-7-one |
| Synonym | Source |
|---|---|
| Dauriporphine | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:88142-60-3 | ChemIDplus |
| Citations |
|---|