EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18NO4 |
| Net Charge | +1 |
| Average Mass | 324.356 |
| Monoisotopic Mass | 324.12303 |
| SMILES | COc1cc2c(cc1O)-c1cc3ccc(O)c(OC)c3c[n+]1CC2 |
| InChI | InChI=1S/C19H17NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,7-10H,5-6H2,1-2H3,(H-,21,22)/p+1 |
| InChIKey | BENXORZPKXUGMY-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corydalis yanhusuo (ncbitaxon:458692) | - | PubMed (22737858) | |
| Stephania dentifolia (ncbitaxon:1501456) | root (BTO:0001188) | PubMed (23713286) | |
| Stephania venosa (ncbitaxon:527508) | tuber (BTO:0001400) | PubMed (16640839) | |
| Tinospora capillipes (ncbitaxon:150903) | root (BTO:0001188) | PubMed (17340259) | |
| Xylopia parviflora (ncbitaxon:992813) | |||
| bark (BTO:0001301) | PubMed (15081299) | ||
| root (BTO:0001188) | PubMed (15081299) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stepharanine (CHEBI:132718) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| stepharanine (CHEBI:132718) has role plant metabolite (CHEBI:76924) |
| stepharanine (CHEBI:132718) is a berberine alkaloid (CHEBI:22754) |
| stepharanine (CHEBI:132718) is a organic cation (CHEBI:25697) |
| stepharanine (CHEBI:132718) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 2,10-dihydroxy-3,9-dimethoxy-5,6-dihydroisoquinolino[3,2-a]isoquinolin-7-ium |
| Synonym | Source |
|---|---|
| Stepharanin | KNApSAcK |
| Citations |
|---|