EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO3 |
| Net Charge | 0 |
| Average Mass | 297.354 |
| Monoisotopic Mass | 297.13649 |
| SMILES | [H][C@@]12CC3(C=CC(=O)C=C3)c3c(OC)c(OC)cc(c31)CCN2 |
| InChI | InChI=1S/C18H19NO3/c1-21-14-9-11-5-8-19-13-10-18(6-3-12(20)4-7-18)16(15(11)13)17(14)22-2/h3-4,6-7,9,13,19H,5,8,10H2,1-2H3/t13-/m1/s1 |
| InChIKey | OGJKMZVUJJYWKO-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona muricata (ncbitaxon:13337) | |||
| root (BTO:0001188) | PubMed (17401878) | ||
| leaf (BTO:0000713) | PubMed (17401878) | ||
| stem (BTO:0001300) | PubMed (17401878) | ||
| Sarcopetalum harveyanum (ncbitaxon:461626) | - | PubMed (5037484) | |
| Stephania dentifolia (ncbitaxon:1501456) | root (BTO:0001188) | PubMed (23713286) | |
| Stephania viridiflavens (ncbitaxon:1501474) | root (BTO:0001188) | PubMed (20645211) | |
| Stephania yunnanensis (ncbitaxon:152371) | - | PubMed (22041142) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stepharine (CHEBI:132715) has role plant metabolite (CHEBI:76924) |
| stepharine (CHEBI:132715) is a aromatic ether (CHEBI:35618) |
| stepharine (CHEBI:132715) is a azaspiro compound (CHEBI:35624) |
| stepharine (CHEBI:132715) is a enone (CHEBI:51689) |
| stepharine (CHEBI:132715) is a isoquinoline alkaloid (CHEBI:24921) |
| stepharine (CHEBI:132715) is a organic heterotetracyclic compound (CHEBI:38163) |
| stepharine (CHEBI:132715) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (8a'R)-5',6'-dimethoxy-2',3',8',8a'-tetrahydro-1'H,4H-spiro[cyclohexa-2,5-diene-1,7'-cyclopenta[ij]isoquinolin]-4-one |
| Synonyms | Source |
|---|---|
| AI3-34587 | ChemIDplus |
| (R)-stepharine | ChEBI |
| (+)-Stepharine | KNApSAcK |
| Citations |
|---|