EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | CCOC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H12O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3-7,12-13H,2H2,1H3/b6-4+ |
| InChIKey | WDKYDMULARNCIS-GQCTYLIASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ligularia fischeri (ncbitaxon:186954) | - | PubMed (24892518) | |
| Bidens pilosa (ncbitaxon:42337) | - | PubMed (16041399) | |
| Bistorta amplexicaulis subsp. sinensis (ncbitaxon:1224212) | - | Article (Journal of Medicinal Plants Research Vol., 4 May 2011, 5(9), 1685–1691) |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl trans-caffeate (CHEBI:132714) has functional parent trans-caffeic acid (CHEBI:16433) |
| ethyl trans-caffeate (CHEBI:132714) has role anti-inflammatory agent (CHEBI:67079) |
| ethyl trans-caffeate (CHEBI:132714) has role antineoplastic agent (CHEBI:35610) |
| ethyl trans-caffeate (CHEBI:132714) is a alkyl caffeate ester (CHEBI:65331) |
| ethyl trans-caffeate (CHEBI:132714) is a ethyl ester (CHEBI:23990) |
| IUPAC Name |
|---|
| ethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate | IUPAC |
| (E)-ethyl 3,4-dihydroxycinnamate | ChEBI |
| ethyl 3,4-dihydroxycinnamate | ChEBI |
| ethyl caffeate | ChemIDplus |
| (E)-ethyl caffeate | ChEBI |
| (E)-ethyl 3-(3,4-dihydroxyphenyl)acrylate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5317238 | PubChem Compound |
| Ethyl_caffeate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2106401 | Reaxys |
| CAS:102-37-4 | ChemIDplus |
| Citations |
|---|