EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132712 - secoxyloganin
| Formula | C17H24O11 |
| Net Charge | 0 |
| Average Mass | 404.368 |
| Monoisotopic Mass | 404.13186 |
| SMILES | C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C(C(=O)OC)[C@H]1CC(=O)O |
| InChI | InChI=1S/C17H24O11/c1-3-7-8(4-11(19)20)9(15(24)25-2)6-26-16(7)28-17-14(23)13(22)12(21)10(5-18)27-17/h3,6-8,10,12-14,16-18,21-23H,1,4-5H2,2H3,(H,19,20)/t7-,8+,10-,12-,13+,14-,16+,17+/m1/s1 |
| InChIKey | MQLSOVRLZHTATK-PEYNGXJCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lonicera macranthoides (ncbitaxon:638627) | flower bud (BTO:0000470) | PubMed (22822669) | |
| Manulea altissima (ncbitaxon:292437) | - | PubMed (25457503) | |
| Guettarda pohliana (ncbitaxon:336043) | |||
| leaf (BTO:0000713) | PubMed (23387288) | ||
| root (BTO:0001188) | PubMed (23387288) | ||
| Olea europaea (ncbitaxon:4146) | |||
| leaf (BTO:0000713) | PubMed (25102361) | ||
| fruit (BTO:0000486) | PubMed (35137662) | ||
| Lonicera fragrantissima (ncbitaxon:486666) | flower (BTO:0000469) | PubMed (25726645) | |
| Catharanthus roseus (ncbitaxon:4058) | - | PubMed (26285573) | |
| Palicourea rigida (ncbitaxon:96266) | |||
| flower (BTO:0000469) | PubMed (26927220) | ||
| root (BTO:0001188) | PubMed (26927220) | ||
| leaf (BTO:0000713) | PubMed (26927220) | ||
| Lonicera japonica (ncbitaxon:105884) | |||
| leaf (BTO:0000713) | PubMed (23265495) | ||
| flower (BTO:0000469) | PubMed (21804227) | ||
| Lonicera caerulea var. kamtschatica (ncbitaxon:760126) | fruit (BTO:0000486) | PubMed (27598106) | |
| Guettarda platypoda (ncbitaxon:339301) | Root (BTO:0001188) | PubMed (3247336) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| secoxyloganin (CHEBI:132712) has role anti-allergic agent (CHEBI:50857) |
| secoxyloganin (CHEBI:132712) has role antioxidant (CHEBI:22586) |
| secoxyloganin (CHEBI:132712) has role plant metabolite (CHEBI:76924) |
| secoxyloganin (CHEBI:132712) is a dicarboxylic acid monoester (CHEBI:36244) |
| secoxyloganin (CHEBI:132712) is a enoate ester (CHEBI:51702) |
| secoxyloganin (CHEBI:132712) is a methyl ester (CHEBI:25248) |
| secoxyloganin (CHEBI:132712) is a monosaccharide derivative (CHEBI:63367) |
| secoxyloganin (CHEBI:132712) is a pyrans (CHEBI:26407) |
| secoxyloganin (CHEBI:132712) is a secoiridoid glycoside (CHEBI:50274) |
| secoxyloganin (CHEBI:132712) is a β-D-glucoside (CHEBI:22798) |
| secoxyloganin (CHEBI:132712) is conjugate acid of secoxyloganin(1−) (CHEBI:192364) |
| Incoming Relation(s) |
| secoxyloganin(1−) (CHEBI:192364) is conjugate base of secoxyloganin (CHEBI:132712) |
| IUPAC Name |
|---|
| [(2S,3R,4S)-3-ethenyl-2-(β-D-glucopyranosyloxy)-5-(methoxycarbonyl)-3,4-dihydro-2H-pyran-4-yl]acetic acid |
| Synonyms | Source |
|---|---|
| secoxy-loganin | ChemIDplus |
| (2S,3R,4S)-3-ethenyl-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-2H-pyran-4-acetic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00031346 | KNApSAcK |
| HMDB0258204 | HMDB |
| LMPR01020139 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5458989 | Reaxys |
| CAS:58822-47-2 | ChemIDplus |
| Citations |
|---|