EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37NO3 |
| Net Charge | 0 |
| Average Mass | 375.553 |
| Monoisotopic Mass | 375.27734 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(25)24-21(2)23(26)27/h7-8,10-11,13-14,16-17,21H,3-6,9,12,15,18-20H2,1-2H3,(H,24,25)(H,26,27)/b8-7-,11-10-,14-13-,17-16-/t21-/m0/s1 |
| InChIKey | ZECSOKFEQQDUCP-GDYZQIPQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-arachidonoyl-L-alanine (CHEBI:132708) has functional parent arachidonic acid (CHEBI:15843) |
| N-arachidonoyl-L-alanine (CHEBI:132708) has role mammalian metabolite (CHEBI:75768) |
| N-arachidonoyl-L-alanine (CHEBI:132708) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-arachidonoyl-L-alanine (CHEBI:132708) is a N-acyl-L-alanine (CHEBI:83946) |
| N-arachidonoyl-L-alanine (CHEBI:132708) is conjugate acid of N-arachidonoyl-L-alaninate (CHEBI:132071) |
| Incoming Relation(s) |
| N-arachidonoyl-L-alaninate (CHEBI:132071) is conjugate base of N-arachidonoyl-L-alanine (CHEBI:132708) |
| IUPAC Name |
|---|
| N-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]-L-alanine |
| Synonyms | Source |
|---|---|
| N-[(5Z,8Z,11Z,14Z)-eicosatetraenoyl]alanine | ChEBI |
| N-[(5Z,8Z,11Z,14Z)-eicosatetraenoyl]-L-alanine | ChEBI |
| N-[(5Z,8Z,11Z,14Z)-icosatetraenoyl]alanine | ChEBI |
| N-[(5Z,8Z,11Z,14Z)-icosatetraenoyl]-L-alanine | ChEBI |
| N-arachidonoylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11115229 | Reaxys |
| Citations |
|---|