EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N2O5 |
| Net Charge | 0 |
| Average Mass | 408.454 |
| Monoisotopic Mass | 408.16852 |
| SMILES | [H][C@@]12N3C(=O)C[C@]4([H])OCC=C5CN6C(=O)C[C@@]1(c1cc(OC)c(OC)cc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/C23H24N2O5/c1-28-15-6-13-14(7-16(15)29-2)25-19(26)8-17-21-12-5-18-23(13,22(21)25)9-20(27)24(18)10-11(12)3-4-30-17/h3,6-7,12,17-18,21-22H,4-5,8-10H2,1-2H3/t12-,17-,18-,21-,22-,23+/m0/s1 |
| InChIKey | KPEKABODQFNIAE-DNEHAUKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strychnos nux-vomica (ncbitaxon:28545) | seed (BTO:0001226) | DOI (10.1016/j.tet.2012.03.006) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxobrucine (CHEBI:132707) has functional parent brucine (CHEBI:3193) |
| 5-oxobrucine (CHEBI:132707) is a aromatic ether (CHEBI:35618) |
| 5-oxobrucine (CHEBI:132707) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| 5-oxobrucine (CHEBI:132707) is a organic heteroheptacyclic compound (CHEBI:52157) |
| 5-oxobrucine (CHEBI:132707) is a γ-lactam (CHEBI:74222) |
| 5-oxobrucine (CHEBI:132707) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| 2,3-dimethoxystrychnidine-10,18-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22594459 | Reaxys |