EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N2O3 |
| Net Charge | 0 |
| Average Mass | 350.418 |
| Monoisotopic Mass | 350.16304 |
| SMILES | [H][C@@]12N3C(=O)C[C@]4([H])OCC=C5C[N+]6([O-])CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/C21H22N2O3/c24-18-10-16-19-13-9-17-21(6-7-23(17,25)11-12(13)5-8-26-16)14-3-1-2-4-15(14)22(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+,23?/m0/s1 |
| InChIKey | ADTDBAKUQAKBGZ-VXJIXCKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strychnos icaja (ncbitaxon:1040889) | root (BTO:0001188) | PubMed (12560037) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnine N-oxide (CHEBI:132703) has functional parent strychnine (CHEBI:28973) |
| strychnine N-oxide (CHEBI:132703) has role plant metabolite (CHEBI:76924) |
| strychnine N-oxide (CHEBI:132703) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| strychnine N-oxide (CHEBI:132703) is a organic heteroheptacyclic compound (CHEBI:52157) |
| strychnine N-oxide (CHEBI:132703) is a tertiary amine oxide (CHEBI:134363) |
| IUPAC Name |
|---|
| (1S,11S,18S,20R,21R,22S)-12-oxa-8,17-diazaheptacyclo[15.5.2.01,18.02,7.08,22.011,21.015,20]tetracosa-2,4,6,14-tetraen-9-one 17-oxide |
| Synonyms | Source |
|---|---|
| N-oxystrychnine | ChemIDplus |
| genostrychnine | ChemIDplus |
| strychnidin-10-one, 19-oxide | ChemIDplus |
| strychnine 19-oxide | ChemIDplus |
| strychnine-N-oxide | ChemIDplus |
| strychnine N6-oxide | ChemIDplus |
| Citations |
|---|