EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H]1O[C@H]1C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)OO |
| InChI | InChI=1S/C20H32O5/c1-2-3-10-14-18-19(24-18)16-17(25-23)13-11-8-6-4-5-7-9-12-15-20(21)22/h5-8,11,13,17-19,23H,2-4,9-10,12,14-16H2,1H3,(H,21,22)/b7-5-,8-6-,13-11+/t17-,18-,19+/m1/s1 |
| InChIKey | FRAUAYJDJWCREF-FEXRMQIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (25293588) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25293588) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-icosatrienoic acid (CHEBI:132681) has role human xenobiotic metabolite (CHEBI:76967) |
| (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-icosatrienoic acid (CHEBI:132681) has role mouse metabolite (CHEBI:75771) |
| (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-icosatrienoic acid (CHEBI:132681) is a hydroperoxy(epoxy)icosatrienoic acid (CHEBI:134641) |
| (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-icosatrienoic acid (CHEBI:132681) is conjugate acid of (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-icosatrienoate (CHEBI:132065) |
| Incoming Relation(s) |
| (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-icosatrienoate (CHEBI:132065) is conjugate base of (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-icosatrienoic acid (CHEBI:132681) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,12S)-12-hydroperoxy-13-[(2S,3R)-3-pentyloxiran-2-yl]trideca-5,8,10-trienoic acid |
| Synonyms | Source |
|---|---|
| (12S)-hydroperoxy-(14S,15R)-epoxy-(5Z,8Z,10E)-eicosatrienoic acid | ChEBI |
| (12S)-hydroperoxy-(14S,15R)-EET | ChEBI |
| (12S)-HP-(14S,15R)-EET | ChEBI |
| Citations |
|---|