EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O3 |
| Net Charge | 0 |
| Average Mass | 364.445 |
| Monoisotopic Mass | 364.17869 |
| SMILES | [H][C@@]12N3C(=O)C[C@]4([H])OCC=C5CN(C)CC[C@]1(C(=O)C[C@]5([H])[C@]24[H])c1ccccc13 |
| InChI | InChI=1S/C22H24N2O3/c1-23-8-7-22-15-4-2-3-5-16(15)24-19(26)11-17-20(21(22)24)14(10-18(22)25)13(12-23)6-9-27-17/h2-6,14,17,20-21H,7-12H2,1H3/t14-,17-,20-,21-,22+/m0/s1 |
| InChIKey | RNZRHJNFQWMXHB-ZXXLSYNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strychnos icaja (ncbitaxon:1040889) | leaf (BTO:0000713) | PubMed (4954818) | |
| Strychnos nux-vomica (ncbitaxon:28545) | seed (BTO:0001226) | PubMed (16317898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icajine (CHEBI:132668) has role plant metabolite (CHEBI:76924) |
| icajine (CHEBI:132668) has role sodium channel blocker (CHEBI:38633) |
| icajine (CHEBI:132668) is a cyclic ketone (CHEBI:3992) |
| icajine (CHEBI:132668) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| icajine (CHEBI:132668) is a organic heterohexacyclic compound (CHEBI:51914) |
| icajine (CHEBI:132668) is a tertiary amino compound (CHEBI:50996) |
| icajine (CHEBI:132668) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| (4aR,6aS,12aS,12bR,12cS)-15-methyl-4a,5,12,12a,12b,12c-hexahydro-11H-6a,4-(ethanoiminomethano)-1-oxa-10b-azacyclohepta[1,2,3-cd]fluoranthene-6,11(2H)-dione |
| Synonym | Source |
|---|---|
| 19-methyl-16,19-seco-strychnidine-10,16-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1093794 | Reaxys |
| Reaxys:59544 | Reaxys |
| CAS:5525-31-5 | ChemIDplus |
| Citations |
|---|