EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O2 |
| Net Charge | 0 |
| Average Mass | 288.431 |
| Monoisotopic Mass | 288.20893 |
| SMILES | CCCCCCCCCC/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14-18-19(15-17)21-16-20-18/h11-15H,2-10,16H2,1H3/b12-11+ |
| InChIKey | CXFWEZQTIXOIEV-VAWYXSNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper longum (ncbitaxon:49511) | - | PubMed (16872768) | |
| Caesalpinia bonduc (ncbitaxon:191881) | bark (BTO:0001301) | PubMed (17329887) | Obtained from ethanolic extract of the bark |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipataline (CHEBI:132658) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| pipataline (CHEBI:132658) has role plant metabolite (CHEBI:76924) |
| pipataline (CHEBI:132658) is a benzodioxoles (CHEBI:38298) |
| pipataline (CHEBI:132658) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 5-[(1E)-dodec-1-en-1-yl]-2H-1,3-benzodioxole |
| Manual Xrefs | Databases |
|---|---|
| C00031033 | KNApSAcK |
| CA2505140 | Patent |
| CN1708312 | Patent |
| US7081260 | Patent |
| US2004081711 | Patent |
| EP1562617 | Patent |
| WO2004041295 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1317727 | Reaxys |
| CAS:18634-87-2 | KNApSAcK |
| Citations |
|---|