EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132657 - piperlactam S
| Formula | C17H13NO4 |
| Net Charge | 0 |
| Average Mass | 295.294 |
| Monoisotopic Mass | 295.08446 |
| SMILES | COc1c(O)cc2c3c(cc4ccccc4c13)N(OC)C2=O |
| InChI | InChI=1S/C17H13NO4/c1-21-16-13(19)8-11-14-12(18(22-2)17(11)20)7-9-5-3-4-6-10(9)15(14)16/h3-8,19H,1-2H3 |
| InChIKey | LHSDJNRAZBFFLF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper kadsura (ncbitaxon:54803) | - | PubMed (11040054) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperlactam S (CHEBI:132657) has role anti-inflammatory agent (CHEBI:67079) |
| piperlactam S (CHEBI:132657) has role antioxidant (CHEBI:22586) |
| piperlactam S (CHEBI:132657) has role plant metabolite (CHEBI:76924) |
| piperlactam S (CHEBI:132657) is a alkaloid (CHEBI:22315) |
| piperlactam S (CHEBI:132657) is a aromatic ether (CHEBI:35618) |
| piperlactam S (CHEBI:132657) is a organic heterotetracyclic compound (CHEBI:38163) |
| piperlactam S (CHEBI:132657) is a phenols (CHEBI:33853) |
| piperlactam S (CHEBI:132657) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| 2-hydroxy-1,5-dimethoxydibenzo[cd,f]indol-4(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7651039 | Reaxys |
| Citations |
|---|