EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O5 |
| Net Charge | 0 |
| Average Mass | 328.364 |
| Monoisotopic Mass | 328.13107 |
| SMILES | [H]C(=O)c1cc(OC)c2c(c1)[C@H](C)[C@@H](c1ccc(OC)c(OC)c1)O2 |
| InChI | InChI=1S/C19H20O5/c1-11-14-7-12(10-20)8-17(23-4)19(14)24-18(11)13-5-6-15(21-2)16(9-13)22-3/h5-11,18H,1-4H3/t11-,18-/m0/s1 |
| InChIKey | XBEUHOWSGYZENI-VOJFVSQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Magnolia ovata (ncbitaxon:152188) | |||
| leaf (BTO:0000713) | PubMed (19658431) | ||
| fruit (BTO:0000486) | PubMed (23157012) | ||
| Piper kadsura (ncbitaxon:54803) | - | PubMed (8237383) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kadsurenin M (CHEBI:132654) has role plant metabolite (CHEBI:76924) |
| kadsurenin M (CHEBI:132654) is a 1-benzofurans (CHEBI:38830) |
| kadsurenin M (CHEBI:132654) is a arenecarbaldehyde (CHEBI:33855) |
| kadsurenin M (CHEBI:132654) is a dimethoxybenzene (CHEBI:51681) |
| kadsurenin M (CHEBI:132654) is a neolignan (CHEBI:25497) |
| kadsurenin M (CHEBI:132654) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2S,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
| Synonym | Source |
|---|---|
| 7S,8S-3,4,3'-Trimethoxy-7'-oxo-nor-8',9'-7.O.4',8,5'-neolignan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19936899 | Reaxys |
| CAS:150133-00-9 | ChemIDplus |
| Citations |
|---|