EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132653 - kadsurenin L
| Formula | C23H28O6 |
| Net Charge | 0 |
| Average Mass | 400.471 |
| Monoisotopic Mass | 400.18859 |
| SMILES | [H][C@]12C(=O)C(CC=C)=C[C@](OC)([C@H](C)[C@H]1c1ccc(OC)c(OC)c1)[C@H]2OC(C)=O |
| InChI | InChI=1S/C23H28O6/c1-7-8-16-12-23(28-6)13(2)19(20(21(16)25)22(23)29-14(3)24)15-9-10-17(26-4)18(11-15)27-5/h7,9-13,19-20,22H,1,8H2,2-6H3/t13-,19+,20-,22+,23+/m1/s1 |
| InChIKey | TVDQUJSTRADHSU-WWDCKHPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper kadsura (ncbitaxon:54803) | - | PubMed (8368081) |
| Roles Classification |
|---|
| Biological Roles: | platelet-activating factor receptor antagonist An antagonist that acts at the platelet-activating factor receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kadsurenin L (CHEBI:132653) has role plant metabolite (CHEBI:76924) |
| kadsurenin L (CHEBI:132653) has role platelet-activating factor receptor antagonist (CHEBI:134182) |
| kadsurenin L (CHEBI:132653) is a acetate ester (CHEBI:47622) |
| kadsurenin L (CHEBI:132653) is a bridged compound (CHEBI:35990) |
| kadsurenin L (CHEBI:132653) is a carbobicyclic compound (CHEBI:36785) |
| kadsurenin L (CHEBI:132653) is a cyclic ketone (CHEBI:3992) |
| kadsurenin L (CHEBI:132653) is a dimethoxybenzene (CHEBI:51681) |
| kadsurenin L (CHEBI:132653) is a enone (CHEBI:51689) |
| kadsurenin L (CHEBI:132653) is a neolignan (CHEBI:25497) |
| IUPAC Name |
|---|
| (1R,5S,6R,7R,8S)-6-(3,4-dimethoxyphenyl)-1-methoxy-7-methyl-4-oxo-3-(prop-2-en-1-yl)bicyclo[3.2.1]oct-2-en-8-yl acetate |
| Synonym | Source |
|---|---|
| delta(8')-3,4,5'-Trimethoxy-4'-acetoxy-2',3',4',5'-tetrahydro-2'-oxo-7.3',8.5'-neolignan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20034355 | Reaxys |
| CAS:149438-61-9 | ChemIDplus |
| Citations |
|---|