EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O5 |
| Net Charge | 0 |
| Average Mass | 342.391 |
| Monoisotopic Mass | 342.14672 |
| SMILES | [H][C@@]12C(=O)C(CC=C)=C[C@@](OC)(C1=O)[C@H](C)[C@H]2c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H22O5/c1-5-6-13-10-20(25-4)11(2)16(17(18(13)22)19(20)23)12-7-8-14(21)15(9-12)24-3/h5,7-11,16-17,21H,1,6H2,2-4H3/t11-,16+,17-,20+/m1/s1 |
| InChIKey | QPJPDAWUDLZIDJ-MGMUYRNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper kadsura (ncbitaxon:54803) | - | PubMed (8368081) |
| Roles Classification |
|---|
| Biological Roles: | platelet-activating factor receptor antagonist An antagonist that acts at the platelet-activating factor receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kadsurenin K (CHEBI:132652) has role plant metabolite (CHEBI:76924) |
| kadsurenin K (CHEBI:132652) has role platelet-activating factor receptor antagonist (CHEBI:134182) |
| kadsurenin K (CHEBI:132652) is a bridged compound (CHEBI:35990) |
| kadsurenin K (CHEBI:132652) is a carbobicyclic compound (CHEBI:36785) |
| kadsurenin K (CHEBI:132652) is a cyclic ketone (CHEBI:3992) |
| kadsurenin K (CHEBI:132652) is a enone (CHEBI:51689) |
| kadsurenin K (CHEBI:132652) is a guaiacols (CHEBI:134251) |
| kadsurenin K (CHEBI:132652) is a neolignan (CHEBI:25497) |
| IUPAC Name |
|---|
| (1R,5R,6R,7R)-7-(4-hydroxy-3-methoxyphenyl)-5-methoxy-6-methyl-3-(prop-2-en-1-yl)bicyclo[3.2.1]oct-3-ene-2,8-dione |
| Synonym | Source |
|---|---|
| delta(8')-3,5'-Dimethoxy-4-hydroxy-2',3',4',5'-tetrahydro-2',4'-dioxo-7.3',8.5'-neolignan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:149560-83-8 | ChemIDplus |
| Citations |
|---|