EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O5 |
| Net Charge | 0 |
| Average Mass | 358.434 |
| Monoisotopic Mass | 358.17802 |
| SMILES | [H][C@]12C(=O)C(CC=C)=C[C@](OC)([C@H](C)[C@H]1c1ccc(OC)c(OC)c1)[C@@H]2O |
| InChI | InChI=1S/C21H26O5/c1-6-7-14-11-21(26-5)12(2)17(18(19(14)22)20(21)23)13-8-9-15(24-3)16(10-13)25-4/h6,8-12,17-18,20,23H,1,7H2,2-5H3/t12-,17+,18-,20-,21+/m1/s1 |
| InChIKey | YYEUHNBQISBESB-OFUJBLJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper kadsura (ncbitaxon:54803) | - | PubMed (8368081) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. platelet-activating factor receptor antagonist An antagonist that acts at the platelet-activating factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kadsurenin C (CHEBI:132651) has role plant metabolite (CHEBI:76924) |
| kadsurenin C (CHEBI:132651) has role platelet-activating factor receptor antagonist (CHEBI:134182) |
| kadsurenin C (CHEBI:132651) is a bridged compound (CHEBI:35990) |
| kadsurenin C (CHEBI:132651) is a carbobicyclic compound (CHEBI:36785) |
| kadsurenin C (CHEBI:132651) is a cyclic ketone (CHEBI:3992) |
| kadsurenin C (CHEBI:132651) is a dimethoxybenzene (CHEBI:51681) |
| kadsurenin C (CHEBI:132651) is a enone (CHEBI:51689) |
| kadsurenin C (CHEBI:132651) is a neolignan (CHEBI:25497) |
| kadsurenin C (CHEBI:132651) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,5S,6R,7R,8R)-7-(3,4-dimethoxyphenyl)-8-hydroxy-5-methoxy-6-methyl-3-(prop-2-en-1-yl)bicyclo[3.2.1]oct-3-en-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9656986 | Reaxys |
| Citations |
|---|