EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | C=CC[C@@]12C=C(OC)C(=O)C=C1O[C@H](c1ccc3c(c1)OCO3)[C@H]2C |
| InChI | InChI=1S/C20H20O5/c1-4-7-20-10-17(22-3)14(21)9-18(20)25-19(12(20)2)13-5-6-15-16(8-13)24-11-23-15/h4-6,8-10,12,19H,1,7,11H2,2-3H3/t12-,19+,20+/m1/s1 |
| InChIKey | SOLJFAQVSWXZEQ-CFGAKRJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ocotea cymbarum (ncbitaxon:1844648) | - | PubMed (24713267) | |
| Piper wallichii (ncbitaxon:450288) | aerial part (BTO:0001658) | PubMed (20394289) |
| Roles Classification |
|---|
| Biological Roles: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| burchellin (CHEBI:132650) has role antifeedant (CHEBI:22583) |
| burchellin (CHEBI:132650) has role plant metabolite (CHEBI:76924) |
| burchellin (CHEBI:132650) has role trypanocidal drug (CHEBI:36335) |
| burchellin (CHEBI:132650) is a 1-benzofurans (CHEBI:38830) |
| burchellin (CHEBI:132650) is a benzodioxoles (CHEBI:38298) |
| burchellin (CHEBI:132650) is a cyclic ketone (CHEBI:3992) |
| burchellin (CHEBI:132650) is a enol ether (CHEBI:47985) |
| burchellin (CHEBI:132650) is a enone (CHEBI:51689) |
| burchellin (CHEBI:132650) is a neolignan (CHEBI:25497) |
| burchellin (CHEBI:132650) is a olefinic compound (CHEBI:78840) |
| burchellin (CHEBI:132650) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2S,3S,3aR)-2-(2H-1,3-benzodioxol-5-yl)-5-methoxy-3-methyl-3a-(prop-2-en-1-yl)-3,3a-dihydro-1-benzofuran-6(2H)-one |
| Manual Xrefs | Databases |
|---|---|
| C00041404 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1355484 | Reaxys |
| CAS:38276-59-4 | KNApSAcK |
| CAS:38276-59-4 | ChemIDplus |
| Citations |
|---|