EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O5 |
| Net Charge | 0 |
| Average Mass | 372.461 |
| Monoisotopic Mass | 372.19367 |
| SMILES | COc1ccc([C@H]2O[C@@H](c3ccc(OC)c(OC)c3)[C@H](C)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14+,21-,22+ |
| InChIKey | JLJAVUZBHSLLJL-DQEHQXCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus tatarinowii (ncbitaxon:123564) | rhizome (BTO:0001181) | PubMed (23713285) | |
| Aristolochia arcuata (ncbitaxon:158533) | - | PubMed (15684486) | |
| Machilus thunbergii (ncbitaxon:128685) | bark (BTO:0001301) | PubMed (19555186) | |
| Nectandra megapotamica (ncbitaxon:881593) | |||
| - | PubMed (15324487) | ||
| leaf (BTO:0000713) | PubMed (26184150) | ||
| Nectandra rigida (ncbitaxon:881595) | - | PubMed (7400821) | |
| Piper mullesua (ncbitaxon:126644) | - | PubMed (CBA:310781) | |
| Piper wallichii (ncbitaxon:450288) | - | PubMed (2609983) | |
| Schisandra propinqua (ncbitaxon:124790) | stem (BTO:0001300) | PubMed (18536373) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galgravin (CHEBI:132648) has role bone density conservation agent (CHEBI:50646) |
| galgravin (CHEBI:132648) has role neuroprotective agent (CHEBI:63726) |
| galgravin (CHEBI:132648) has role plant metabolite (CHEBI:76924) |
| galgravin (CHEBI:132648) has role platelet aggregation inhibitor (CHEBI:50427) |
| galgravin (CHEBI:132648) is a aryltetrahydrofuran (CHEBI:47021) |
| galgravin (CHEBI:132648) is a dimethoxybenzene (CHEBI:51681) |
| galgravin (CHEBI:132648) is a lignan (CHEBI:25036) |
| galgravin (CHEBI:132648) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2R,3R,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane |
| Manual Xrefs | Databases |
|---|---|
| C00007212 | KNApSAcK |
| CN101085129 | Patent |
| US2008214661 | Patent |
| WO2006113981 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:97007 | Reaxys |
| CAS:528-63-2 | ChemIDplus |
| CAS:528-63-2 | KNApSAcK |
| Citations |
|---|