EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132648 - galgravin
| Formula | C22H28O5 |
| Net Charge | 0 |
| Average Mass | 372.461 |
| Monoisotopic Mass | 372.19367 |
| SMILES | COc1ccc([C@H]2O[C@@H](c3ccc(OC)c(OC)c3)[C@H](C)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14+,21-,22+ |
| InChIKey | JLJAVUZBHSLLJL-DQEHQXCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus tatarinowii (ncbitaxon:123564) | rhizome (BTO:0001181) | PubMed (23713285) | |
| Aristolochia arcuata (ncbitaxon:158533) | - | PubMed (15684486) | |
| Machilus thunbergii (ncbitaxon:128685) | bark (BTO:0001301) | PubMed (19555186) | |
| Nectandra megapotamica (ncbitaxon:881593) | |||
| - | PubMed (15324487) | ||
| leaf (BTO:0000713) | PubMed (26184150) | ||
| Nectandra rigida (ncbitaxon:881595) | - | PubMed (7400821) | |
| Piper mullesua (ncbitaxon:126644) | - | PubMed (CBA:310781) | |
| Piper wallichii (ncbitaxon:450288) | - | PubMed (2609983) | |
| Schisandra propinqua (ncbitaxon:124790) | stem (BTO:0001300) | PubMed (18536373) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galgravin (CHEBI:132648) has role bone density conservation agent (CHEBI:50646) |
| galgravin (CHEBI:132648) has role neuroprotective agent (CHEBI:63726) |
| galgravin (CHEBI:132648) has role plant metabolite (CHEBI:76924) |
| galgravin (CHEBI:132648) has role platelet aggregation inhibitor (CHEBI:50427) |
| galgravin (CHEBI:132648) is a aryltetrahydrofuran (CHEBI:47021) |
| galgravin (CHEBI:132648) is a dimethoxybenzene (CHEBI:51681) |
| galgravin (CHEBI:132648) is a lignan (CHEBI:25036) |
| galgravin (CHEBI:132648) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2R,3R,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane |
| Manual Xrefs | Databases |
|---|---|
| C00007212 | KNApSAcK |
| CN101085129 | Patent |
| US2008214661 | Patent |
| WO2006113981 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:97007 | Reaxys |
| CAS:528-63-2 | ChemIDplus |
| CAS:528-63-2 | KNApSAcK |
| Citations |
|---|