EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | COC1=C[C@]23C[C@H](C[C@H](c4ccc5c(c4)OCO5)[C@H]2C)OC3=CC1=O |
| InChI | InChI=1S/C20H20O5/c1-11-14(12-3-4-16-17(5-12)24-10-23-16)6-13-8-20(11)9-18(22-2)15(21)7-19(20)25-13/h3-5,7,9,11,13-14H,6,8,10H2,1-2H3/t11-,13+,14+,20-/m1/s1 |
| InChIKey | SXHVHWXETMBKPP-KXXATPMCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper wallichii (ncbitaxon:450288) | stem (BTO:0001300) | PubMed (22734410) | |
| Magnolia sprengeri (ncbitaxon:86737) | - | PubMed (22080044) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| futoenone (CHEBI:132647) has role plant metabolite (CHEBI:76924) |
| futoenone (CHEBI:132647) is a benzodioxoles (CHEBI:38298) |
| futoenone (CHEBI:132647) is a bridged compound (CHEBI:35990) |
| futoenone (CHEBI:132647) is a cyclic ketone (CHEBI:3992) |
| futoenone (CHEBI:132647) is a enol ether (CHEBI:47985) |
| futoenone (CHEBI:132647) is a enone (CHEBI:51689) |
| futoenone (CHEBI:132647) is a neolignan (CHEBI:25497) |
| futoenone (CHEBI:132647) is a organic heterotricyclic compound (CHEBI:26979) |
| futoenone (CHEBI:132647) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2S,4S,5R,5aS)-4-(2H-1,3-benzodioxol-5-yl)-7-methoxy-5-methyl-2,3,4,5-tetrahydro-8H-2,5a-methano-1-benzoxepin-8-one |
| Synonyms | Source |
|---|---|
| (-)-Futoenone | KNApSAcK |
| OAS 1136 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00041535 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6538259 | Reaxys |
| CAS:19913-01-0 | KNApSAcK |
| Citations |
|---|