EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H49NO11 |
| Net Charge | 0 |
| Average Mass | 659.773 |
| Monoisotopic Mass | 659.33056 |
| SMILES | [H][C@@]12C[C@]3(O)[C@@H](OC)C[C@@](OC(C)=O)([C@@]1([H])[C@H]3OC(=O)c1ccc(OC)cc1)[C@]1([H])C3N(CC)C[C@]4(COC)[C@H](O)C[C@H](OC)[C@@]32[C@]4([H])[C@H]1OC |
| InChI | InChI=1S/C35H49NO11/c1-8-36-16-32(17-41-3)22(38)13-23(43-5)35-21-14-33(40)24(44-6)15-34(47-18(2)37,26(29(35)36)27(45-7)28(32)35)25(21)30(33)46-31(39)19-9-11-20(42-4)12-10-19/h9-12,21-30,38,40H,8,13-17H2,1-7H3/t21-,22-,23+,24+,25-,26+,27+,28-,29?,30-,32+,33+,34-,35+/m1/s1 |
| InChIKey | LLEMSCWAKNQHHA-SQJQOUDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aconitum piepunense (ncbitaxon:226113) | root (BTO:0001188) | PubMed (16755043) | |
| Aconitum nagarum (ncbitaxon:50874) | root (BTO:0001188) | PubMed (CBA:335013) | |
| Aconitum bulleyanum (ncbitaxon:226111) | - | PubMed (24380280) | |
| Aconitum episcopale (ncbitaxon:226106) | root (BTO:0001188) | PubMed (21417277) | |
| Aconitum hemsleyanum var. circinatum (ncbitaxon:632157) | root (BTO:0001188) | PubMed (17432903) | |
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (16959134) | |
| Aconitum vilmorinianum (ncbitaxon:226101) | - | PubMed (23784883) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. phytotoxin Any toxin produced by a plant. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yunaconitine (CHEBI:132640) has parent hydride aconitane (CHEBI:35911) |
| yunaconitine (CHEBI:132640) has role antifeedant (CHEBI:22583) |
| yunaconitine (CHEBI:132640) has role human urinary metabolite (CHEBI:84087) |
| yunaconitine (CHEBI:132640) has role phytotoxin (CHEBI:38231) |
| yunaconitine (CHEBI:132640) has role plant metabolite (CHEBI:76924) |
| yunaconitine (CHEBI:132640) has role xenobiotic (CHEBI:35703) |
| yunaconitine (CHEBI:132640) is a acetate ester (CHEBI:47622) |
| yunaconitine (CHEBI:132640) is a aromatic ether (CHEBI:35618) |
| yunaconitine (CHEBI:132640) is a benzoate ester (CHEBI:36054) |
| yunaconitine (CHEBI:132640) is a bridged compound (CHEBI:35990) |
| yunaconitine (CHEBI:132640) is a diterpene alkaloid (CHEBI:23847) |
| yunaconitine (CHEBI:132640) is a organic heteropolycyclic compound (CHEBI:38166) |
| yunaconitine (CHEBI:132640) is a polyether (CHEBI:46774) |
| yunaconitine (CHEBI:132640) is a secondary alcohol (CHEBI:35681) |
| yunaconitine (CHEBI:132640) is a tertiary alcohol (CHEBI:26878) |
| yunaconitine (CHEBI:132640) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-(acetyloxy)-20-ethyl-3α,13-dihydroxy-1α,6α,16β-trimethoxy-4-(methoxymethyl)aconitan-14α-yl 4-methoxybenzoate |
| Synonyms | Source |
|---|---|
| 3-alpha,13-Dihydroxyforesaconitine | ChemIDplus |
| Isoaconitine | ChemIDplus |
| Vilmorrianine B | ChemIDplus |
| Guayewuanine B | ChemIDplus |
| (1α,3α,6α,14α,16β)-8-(acetyloxy)-20-ethyl-3,13-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl 4-methoxybenzoate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C00029255 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5719764 | Reaxys |
| Reaxys:5208037 | Reaxys |
| Reaxys:9376610 | Reaxys |
| CAS:70578-24-4 | KNApSAcK |
| CAS:70578-24-4 | ChemIDplus |
| Citations |
|---|