EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H45NO10 |
| Net Charge | 0 |
| Average Mass | 603.709 |
| Monoisotopic Mass | 603.30435 |
| SMILES | [H][C@@]12C[C@]3(O)[C@@H](OC)[C@H](O)[C@@](O)([C@@]1([H])[C@H]3OC(=O)c1ccccc1)[C@]1([H])C3N(CC)C[C@]4(COC)[C@H](O)C[C@H](OC)[C@@]32[C@]4([H])[C@H]1OC |
| InChI | InChI=1S/C32H45NO10/c1-6-33-14-29(15-39-2)18(34)12-19(40-3)31-17-13-30(37)26(43-28(36)16-10-8-7-9-11-16)20(17)32(38,25(35)27(30)42-5)21(24(31)33)22(41-4)23(29)31/h7-11,17-27,34-35,37-38H,6,12-15H2,1-5H3/t17-,18-,19+,20-,21+,22+,23-,24?,25+,26-,27+,29+,30-,31+,32-/m1/s1 |
| InChIKey | DHJXZSFKLJCHLH-KYSNEVMMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aconitum anthora (ncbitaxon:112588) | whole plant (BTO:0001461) | PubMed (20862641) | |
| Aconitum carmichaelii (ncbitaxon:85363) | - | PubMed (24793215) | |
| Aconitum kusnezoffii (ncbitaxon:239685) | - | PubMed (24170571) | |
| Aconitum pendulum (ncbitaxon:50878) | - | PubMed (26896350) | |
| Aconitum soongaricum (ncbitaxon:568276) | whole plant (BTO:0001461) | PubMed (27328130) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | phytotoxin Any toxin produced by a plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzoylaconine (CHEBI:132633) has parent hydride aconitane (CHEBI:35911) |
| benzoylaconine (CHEBI:132633) has role phytotoxin (CHEBI:38231) |
| benzoylaconine (CHEBI:132633) has role plant metabolite (CHEBI:76924) |
| benzoylaconine (CHEBI:132633) is a benzoate ester (CHEBI:36054) |
| benzoylaconine (CHEBI:132633) is a bridged compound (CHEBI:35990) |
| benzoylaconine (CHEBI:132633) is a diterpene alkaloid (CHEBI:23847) |
| benzoylaconine (CHEBI:132633) is a organic heteropolycyclic compound (CHEBI:38166) |
| benzoylaconine (CHEBI:132633) is a polyether (CHEBI:46774) |
| benzoylaconine (CHEBI:132633) is a secondary alcohol (CHEBI:35681) |
| benzoylaconine (CHEBI:132633) is a tertiary alcohol (CHEBI:26878) |
| benzoylaconine (CHEBI:132633) is a tertiary amino compound (CHEBI:50996) |
| benzoylaconine (CHEBI:132633) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 20-ethyl-3α,8,13,15α-tetrahydroxy-1α,6α,16β-trimethoxy-4-(methoxymethyl)aconitan-14α-yl benzoate |
| Synonyms | Source |
|---|---|
| 14-Benzoylaconine | KNApSAcK |
| 14-O-benzoylaconine | ChEBI |
| (1α,3α,6α,14α,15α,16β)-20-ethyl-3,8,13,15-tetrahydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl benzoate | IUPAC |
| aconine 14-benzoate | ChEBI |
| aconine benzoate | ChEBI |
| Benzaconine | ChemIDplus |
| Citations |
|---|