EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | C=C(C)[C@@H]1Cc2c(ccc3ccc(=O)oc23)O1 |
| InChI | InChI=1S/C14H12O3/c1-8(2)12-7-10-11(16-12)5-3-9-4-6-13(15)17-14(9)10/h3-6,12H,1,7H2,2H3/t12-/m0/s1 |
| InChIKey | WLRXMMDATRQQNQ-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Notopterygium incisum (ncbitaxon:54724) | |||
| root (BTO:0001188) | PubMed (20707067) | ||
| rhizome (BTO:0001181) | PubMed (20707067) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-angenomalin (CHEBI:132627) has role plant metabolite (CHEBI:76924) |
| (+)-angenomalin (CHEBI:132627) is a furanocoumarin (CHEBI:24128) |
| (+)-angenomalin (CHEBI:132627) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (8S)-8-(prop-1-en-2-yl)-8,9-dihydro-2H-furo[2,3-h][1]benzopyran-2-one |
| Synonyms | Source |
|---|---|
| angenomalin | ChEBI |
| (S)-angenomalin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9561305 | Reaxys |
| Citations |
|---|