EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O5 |
| Net Charge | 0 |
| Average Mass | 288.299 |
| Monoisotopic Mass | 288.09977 |
| SMILES | [H][C@@]1(C(C)(C)OC(C)=O)Cc2c(ccc3ccc(=O)oc23)O1 |
| InChI | InChI=1S/C16H16O5/c1-9(17)21-16(2,3)13-8-11-12(19-13)6-4-10-5-7-14(18)20-15(10)11/h4-7,13H,8H2,1-3H3/t13-/m0/s1 |
| InChIKey | IQTTZQQJJBEAIM-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica biserrata (ncbitaxon:357970) | root (BTO:0001188) | PubMed (CBA:341485) | |
| Angelica pubescens (ncbitaxon:312530) | root (BTO:0001188) | PubMed (7700984) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (23384552) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| columbianetin acetate (CHEBI:132626) has role plant metabolite (CHEBI:76924) |
| columbianetin acetate (CHEBI:132626) is a acetate ester (CHEBI:47622) |
| columbianetin acetate (CHEBI:132626) is a furanocoumarin (CHEBI:24128) |
| IUPAC Name |
|---|
| 2-[(8S)-2-oxo-8,9-dihydro-2H-furo[2,3-h][1]benzopyran-8-yl]propan-2-yl acetate |
| Synonyms | Source |
|---|---|
| (8S)-columbianetin acetate | ChEBI |
| (8S)-O-acetylcolumbianetin | ChEBI |
| O-Acetylcolumbianetin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00035183 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29562 | Reaxys |
| CAS:23180-65-6 | ChemIDplus |
| Citations |
|---|