EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | COc1ccc2ccc(=O)oc2c1CCC(C)(C)O |
| InChI | InChI=1S/C15H18O4/c1-15(2,17)9-8-11-12(18-3)6-4-10-5-7-13(16)19-14(10)11/h4-7,17H,8-9H2,1-3H3 |
| InChIKey | FYGJNTORCNKCGZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cnidium monnieri (ncbitaxon:94007) | fruit (BTO:0000486) | PubMed (10785419) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deoxymeranzin hydrate (CHEBI:132625) has role plant metabolite (CHEBI:76924) |
| 2'-deoxymeranzin hydrate (CHEBI:132625) is a aromatic ether (CHEBI:35618) |
| 2'-deoxymeranzin hydrate (CHEBI:132625) is a coumarins (CHEBI:23403) |
| 2'-deoxymeranzin hydrate (CHEBI:132625) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 8-(3-hydroxy-3-methylbutyl)-7-methoxy-2H-1-benzopyran-2-one |
| Synonym | Source |
|---|---|
| 2-deoxymeranzin hydrate | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1251894 | Reaxys |
| Citations |
|---|