EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O3 |
| Net Charge | 0 |
| Average Mass | 326.436 |
| Monoisotopic Mass | 326.18819 |
| SMILES | [H][C@@]12CCc3c(ccc(C(C)C)c3OC)[C@@]1(C)CCC1=C2COC1=O |
| InChI | InChI=1S/C21H26O3/c1-12(2)13-5-7-17-15(19(13)23-4)6-8-18-16-11-24-20(22)14(16)9-10-21(17,18)3/h5,7,12,18H,6,8-11H2,1-4H3/t18-,21+/m0/s1 |
| InChIKey | JQYCSQASGZODFD-GHTZIAJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (7102323) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptophenolide methyl ether (CHEBI:132622) has role plant metabolite (CHEBI:76924) |
| triptophenolide methyl ether (CHEBI:132622) is a aromatic ether (CHEBI:35618) |
| triptophenolide methyl ether (CHEBI:132622) is a organic heterotetracyclic compound (CHEBI:38163) |
| triptophenolide methyl ether (CHEBI:132622) is a tetracyclic triterpenoid (CHEBI:26893) |
| triptophenolide methyl ether (CHEBI:132622) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3bR,9bS)-6-methoxy-9b-methyl-7-(propan-2-yl)-3b,4,5,9b,10,11-hexahydrophenanthro[1,2-c]furan-1(3H)-one |
| Manual Xrefs | Databases |
|---|---|
| WO9113627 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7440813 | Reaxys |
| CAS:74311-48-1 | ChemIDplus |
| Citations |
|---|