EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O7 |
| Net Charge | 0 |
| Average Mass | 376.405 |
| Monoisotopic Mass | 376.15220 |
| SMILES | [H][C@@]12C[C@@H]3O[C@@]34[C@H](O)[C@@]3([C@@H](C)CO)O[C@H]3[C@@H]3O[C@@]34[C@@]1(C)CCC1=C2COC1=O |
| InChI | InChI=1S/C20H24O7/c1-8(6-21)18-13(26-18)14-20(27-14)17(2)4-3-9-10(7-24-15(9)22)11(17)5-12-19(20,25-12)16(18)23/h8,11-14,16,21,23H,3-7H2,1-2H3/t8-,11-,12-,13-,14-,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | HPTCYMNPHWXVLA-UBBHAYRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | |||
| leaf (BTO:0000713) | PubMed (1823717) | ||
| root (BTO:0001188) | PubMed (1823717) | ||
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (24096206) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-hydroxytriptolide (CHEBI:132621) has role plant metabolite (CHEBI:76924) |
| 16-hydroxytriptolide (CHEBI:132621) has role rat metabolite (CHEBI:86264) |
| 16-hydroxytriptolide (CHEBI:132621) has role xenobiotic metabolite (CHEBI:76206) |
| 16-hydroxytriptolide (CHEBI:132621) is a diol (CHEBI:23824) |
| 16-hydroxytriptolide (CHEBI:132621) is a epoxide (CHEBI:32955) |
| 16-hydroxytriptolide (CHEBI:132621) is a primary alcohol (CHEBI:15734) |
| 16-hydroxytriptolide (CHEBI:132621) is a secondary alcohol (CHEBI:35681) |
| 16-hydroxytriptolide (CHEBI:132621) is a tetracyclic diterpenoid (CHEBI:52557) |
| 16-hydroxytriptolide (CHEBI:132621) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3bS,4aS,5aS,6R,6aR,7aS,7bS,8aS,8bS)-6-hydroxy-6a-[(2S)-1-hydroxypropan-2-yl]-8b-methyl-3b,4,4a,6,6a,7a,7b,8b,9,10-decahydrotrisoxireno[6,7:8a,9:4b,5]phenanthro[1,2-c]furan-1(3H)-one |
| Synonym | Source |
|---|---|
| (15S)-16-hydroxytriptolide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO9426265 | Patent |
| EP1946758 | Patent |
| WO2008087202 | Patent |
| WO0217931 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29579833 | Reaxys |
| CAS:139713-80-7 | ChemIDplus |
| Citations |
|---|