EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O4 |
| Net Charge | 0 |
| Average Mass | 484.721 |
| Monoisotopic Mass | 484.35526 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@@H](C)[C@H](C(=O)OC)C[C@H](O)[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C31H48O4/c1-18-19(26(34)35-8)17-24(33)29(5)15-16-30(6)20(25(18)29)9-10-22-28(4)13-12-23(32)27(2,3)21(28)11-14-31(22,30)7/h9,18-19,21-22,24-25,33H,10-17H2,1-8H3/t18-,19+,21-,22+,24-,25+,28-,29-,30+,31+/m0/s1 |
| InChIKey | YQPSLCRGQUNTRC-JXIPVQOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium regelii (ncbitaxon:123485) | root (BTO:0001188) | PubMed (2801129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| regelin (CHEBI:132619) has parent hydride ursane (CHEBI:35711) |
| regelin (CHEBI:132619) has role plant metabolite (CHEBI:76924) |
| regelin (CHEBI:132619) is a cyclic ketone (CHEBI:3992) |
| regelin (CHEBI:132619) is a methyl ester (CHEBI:25248) |
| regelin (CHEBI:132619) is a pentacyclic triterpenoid (CHEBI:25872) |
| regelin (CHEBI:132619) is a secondary alcohol (CHEBI:35681) |
| Synonyms | Source |
|---|---|
| Methyl 3-oxo-22-hydroxyurs-12-en-30-oic acid | ChemIDplus |
| Regelin C | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 163808 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| CAS:109974-21-2 | ChemIDplus |
| Citations |
|---|