EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])C[C@@](C)(C(=O)O)C[C@H](O)[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H46O4/c1-25(2)20-10-13-30(7)21(28(20,5)12-11-22(25)31)9-8-18-19-16-26(3,24(33)34)17-23(32)27(19,4)14-15-29(18,30)6/h8,19-21,23,32H,9-17H2,1-7H3,(H,33,34)/t19-,20+,21-,23+,26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | RUJQEBHXYLCSKV-ARWMTBEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptotritepenonic acid A (CHEBI:132618) has functional parent ursane (CHEBI:35711) |
| triptotritepenonic acid A (CHEBI:132618) has role plant metabolite (CHEBI:76924) |
| triptotritepenonic acid A (CHEBI:132618) is a cyclic ketone (CHEBI:3992) |
| triptotritepenonic acid A (CHEBI:132618) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| triptotritepenonic acid A (CHEBI:132618) is a pentacyclic triterpenoid (CHEBI:25872) |
| triptotritepenonic acid A (CHEBI:132618) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (18α,22α)-22-hydroxy-3-oxoolean-12-en-30-oic acid |
| Synonyms | Source |
|---|---|
| 3-Oxo-22alpha-hydroxy-delta(12)-oleanen-29-oic acid | ChemIDplus |
| 3-Oxo-22-hydroxy-olean-12-en-29-oic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 192337 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| CAS:144629-85-6 | ChemIDplus |