EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C)[C@@H](O)C[C@@H](C(=O)O)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-17-18(25(33)34)16-23(32)28(5)14-15-29(6)19(24(17)28)8-9-21-27(4)12-11-22(31)26(2,3)20(27)10-13-30(21,29)7/h8,17-18,20-24,31-32H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20-,21+,22-,23-,24-,27-,28-,29+,30+/m0/s1 |
| InChIKey | IWVWTVWLRSUYNC-YLOASUEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | root (BTO:0001188) | PubMed (2816380) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptotriterpenic acid C (CHEBI:132617) has parent hydride ursane (CHEBI:35711) |
| triptotriterpenic acid C (CHEBI:132617) has role plant metabolite (CHEBI:76924) |
| triptotriterpenic acid C (CHEBI:132617) is a diol (CHEBI:23824) |
| triptotriterpenic acid C (CHEBI:132617) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| triptotriterpenic acid C (CHEBI:132617) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3β,22α)-3,22-dihydroxyurs-12-en-30-oic acid |
| Synonyms | Source |
|---|---|
| tripterygic acid A | ChEBI |
| 3β,22α-dihydroxyurs-12-en-30-oic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 130072 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9826132 | Reaxys |
| Citations |
|---|