EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O4 |
| Net Charge | 0 |
| Average Mass | 346.467 |
| Monoisotopic Mass | 346.21441 |
| SMILES | [H][C@]12CCc3c(OC)c(C(C)C)cc(O)c3[C@]1(C)CCC(=O)[C@@]2(C)CO |
| InChI | InChI=1S/C21H30O4/c1-12(2)14-10-15(23)18-13(19(14)25-5)6-7-16-20(18,3)9-8-17(24)21(16,4)11-22/h10,12,16,22-23H,6-9,11H2,1-5H3/t16-,20+,21-/m0/s1 |
| InChIKey | XGRBHDJWRPUKMD-DQLDELGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (25237706) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptonoterpenol (CHEBI:132613) has role plant metabolite (CHEBI:76924) |
| triptonoterpenol (CHEBI:132613) is a aromatic ether (CHEBI:35618) |
| triptonoterpenol (CHEBI:132613) is a cyclic ketone (CHEBI:3992) |
| triptonoterpenol (CHEBI:132613) is a phenols (CHEBI:33853) |
| triptonoterpenol (CHEBI:132613) is a primary alcohol (CHEBI:15734) |
| triptonoterpenol (CHEBI:132613) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (5β,10α)-11,18-dihydroxy-14-methoxyabieta-8(14),9(11),12-trien-3-one |
| Registry Numbers | Sources |
|---|---|
| CAS:110187-23-0 | ChemIDplus |
| Citations |
|---|