EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | CCC(CCCC(=O)O)COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H20O6/c1-2-11(6-5-9-14(17)18)10-22-16(21)13-8-4-3-7-12(13)15(19)20/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | XFGRNAPKLGXDGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono(5-carboxy-2-ethylpentyl) phthalate (CHEBI:132611) has role xenobiotic (CHEBI:35703) |
| mono(5-carboxy-2-ethylpentyl) phthalate (CHEBI:132611) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-{[(5-carboxy-2-ethylpentyl)oxy]carbonyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 1,2-benzenedicarboxylic acid, mono(5-carboxy-2-ethylpentyl) ester | ChemIDplus |
| 2-ethyl-5-carboxypentyl phthalate | ChemIDplus |
| MECPP | ChEBI |
| phthalic acid, mono(5-carboxy-2-ethylpentyl) ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:40809-41-4 | ChemIDplus |
| Citations |
|---|