EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O4 |
| Net Charge | 0 |
| Average Mass | 248.278 |
| Monoisotopic Mass | 248.10486 |
| SMILES | O=C(O)c1ccccc1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C14H16O4/c15-13(16)11-8-4-5-9-12(11)14(17)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,15,16) |
| InChIKey | PMDKYLLIOLFQPO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monocyclohexyl phthalate (CHEBI:132609) has functional parent cyclohexanol (CHEBI:18099) |
| monocyclohexyl phthalate (CHEBI:132609) has role xenobiotic metabolite (CHEBI:76206) |
| monocyclohexyl phthalate (CHEBI:132609) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-[(cyclohexyloxy)carbonyl]benzoic acid |
| Synonyms | Source |
|---|---|
| 1,2-benzenedicarboxylic acid, monocyclohexyl ester | ChemIDplus |
| 2-(cyclohexyloxycarbonyl)benzoic acid | NIST Chemistry WebBook |
| cyclohexyl hydrogen phthalate | ChemIDplus |
| MCHP | ChemIDplus |
| phthalic acid, monocyclohexyl ester | ChemIDplus |
| Citations |
|---|