EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O5 |
| Net Charge | 0 |
| Average Mass | 292.331 |
| Monoisotopic Mass | 292.13107 |
| SMILES | CCC(CCC(C)=O)COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H20O5/c1-3-12(9-8-11(2)17)10-21-16(20)14-7-5-4-6-13(14)15(18)19/h4-7,12H,3,8-10H2,1-2H3,(H,18,19) |
| InChIKey | HCWNFKHKKHNSSL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (26545148) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono(2-ethyl-5-oxohexyl) phthalate (CHEBI:132606) has role human urinary metabolite (CHEBI:84087) |
| mono(2-ethyl-5-oxohexyl) phthalate (CHEBI:132606) has role human xenobiotic metabolite (CHEBI:76967) |
| mono(2-ethyl-5-oxohexyl) phthalate (CHEBI:132606) is a methyl ketone (CHEBI:51867) |
| mono(2-ethyl-5-oxohexyl) phthalate (CHEBI:132606) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-{[(2-ethyl-5-oxohexyl)oxy]carbonyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 1,2-Benzenedicarboxylic acid, mono(2-ethyl-5-oxohexyl) ester | ChemIDplus |
| Mono(2-ethyl-5-oxohexyl) 1,2-benzenedicarboxylate | ChemIDplus |
| phthalic acid mono(2-ethyl-5-oxohexyl) ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9208634 | Reaxys |
| CAS:40321-98-0 | ChemIDplus |
| Citations |
|---|