EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | CCCCCC(C)OC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C15H20O4/c1-3-4-5-8-11(2)19-15(18)13-10-7-6-9-12(13)14(16)17/h6-7,9-11H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | NTIWNFLUZQSLDR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono-2-heptyl phthalate (CHEBI:132605) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-{[(heptan-2-yl)oxy]carbonyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 1,2-benzenedicarboxylic acid mono-2-heptyl ester | ChEBI |
| phthalic acid mono-2-heptyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2123449 | Reaxys |