EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | CCCCCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H18O4/c1-2-3-4-7-10-18-14(17)12-9-6-5-8-11(12)13(15)16/h5-6,8-9H,2-4,7,10H2,1H3,(H,15,16) |
| InChIKey | XOSNGXNHDRYFEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monohexyl phthalate (CHEBI:132604) has functional parent hexan-1-ol (CHEBI:87393) |
| monohexyl phthalate (CHEBI:132604) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-[(hexyloxy)carbonyl]benzoic acid |
| Synonyms | Source |
|---|---|
| mono-n-hexyl phthalate | ChEBI |
| Hexyl hydrogen phthalate | ChemIDplus |
| 1,2-Benzenedicarboxylic acid, monohexyl ester | ChemIDplus |
| phthalic acid monohexyl ester | ChEBI |
| 2-(Hexyloxycarbonyl)benzoic acid | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3301470 | Reaxys |
| CAS:24539-57-9 | ChemIDplus |
| CAS:24539-57-9 | NIST Chemistry WebBook |
| Citations |
|---|