EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O4 |
| Net Charge | 0 |
| Average Mass | 292.375 |
| Monoisotopic Mass | 292.16746 |
| SMILES | CC(C)CCCCCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C17H24O4/c1-13(2)9-5-3-4-8-12-21-17(20)15-11-7-6-10-14(15)16(18)19/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3,(H,18,19) |
| InChIKey | RNCMBSSLYOAVRT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24865398) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monoisononyl phthalate (CHEBI:132593) has role human xenobiotic metabolite (CHEBI:76967) |
| monoisononyl phthalate (CHEBI:132593) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-{[(7-methyloctyl)oxy]carbonyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 1,2-Benzenedicarboxylic acid, 1-(7-methyloctyl) ester | ChEBI |
| 1,2-benzenedicarboxylic acid mono-7-methyloctyl ester | ChEBI |
| 1,2-benzenedicarboxylic acid monoisononyl ester | ChEBI |
| 1-(7-Methyloctyl) 1,2-benzenedicarboxylate | ChemIDplus |
| mono-7-methyloctyl phthalate | ChEBI |
| phthalic acid mono-7-methyloctyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9784189 | Reaxys |
| CAS:106610-61-1 | ChemIDplus |
| Citations |
|---|